* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC1154780 |
| English Synonyms: | BCH-RESEARCH BC1154780 |
| MDL Number.: | MFCD17133823 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | Cc1ccc2c(c1)nc([nH]2)SCC(C(=O)N)N |
| InChi: | InChI=1S/C11H14N4OS/c1-6-2-3-8-9(4-6)15-11(14-8)17-5-7(12)10(13)16/h2-4,7H,5,12H2,1H3,(H2,13,16)(H,14,15) |
| InChiKey: | InChIKey=ZCNFJWKSMOVKEC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.