* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6240939 |
English Synonyms: | ABAMACHEM ABA-6240939 |
MDL Number.: | MFCD17133824 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | Cc1ccc2c(c1)nc([nH]2)SCC(C(=O)O)N |
InChi: | InChI=1S/C11H13N3O2S/c1-6-2-3-8-9(4-6)14-11(13-8)17-5-7(12)10(15)16/h2-4,7H,5,12H2,1H3,(H,13,14)(H,15,16) |
InChiKey: | InChIKey=LRJXTOIOOKKUBB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.