Molecular Structure:
CCD No.:CCD03399676
SELENA SEL10739875
Formula:C11 H8 Cl N5 O
MolWeight:261.671
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739875 |
| English Synonyms： | SELENA SEL10739875 |
| MDL Number.： | MFCD17133928 |
| H bond acceptor： | 6 |
| H bond donor： | 0 |
| Smile： | COc1c(cccn1)c2nnc3n2nc(cc3)Cl |
| InChi： | InChI=1S/C11H8ClN5O/c1-18-11-7(3-2-6-13-11)10-15-14-9-5-4-8(12)16-17(9)10/h2-6H,1H3 |
| InChiKey： | InChIKey=XJHYCLIYGLIBFI-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
