* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10739912 |
English Synonyms: | SELENA SEL10739912 |
MDL Number.: | MFCD17133965 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CCC(/C(=N/O)/N)NC(=O)c1cccnc1OC |
InChi: | InChI=1S/C11H16N4O3/c1-3-8(9(12)15-17)14-10(16)7-5-4-6-13-11(7)18-2/h4-6,8,17H,3H2,1-2H3,(H2,12,15)(H,14,16) |
InChiKey: | InChIKey=ADTNRIOFONNTJW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.