Molecular Structure:
CCD No.:CCD03399701
SELENA SEL10739927
Formula:C11 H14 N4 O2
MolWeight:234.258
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739927 |
| English Synonyms： | SELENA SEL10739927 |
| MDL Number.： | MFCD17133980 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CNCCc1nnc(o1)c2cccnc2OC |
| InChi： | InChI=1S/C11H14N4O2/c1-12-7-5-9-14-15-11(17-9)8-4-3-6-13-10(8)16-2/h3-4,6,12H,5,7H2,1-2H3 |
| InChiKey： | InChIKey=VICBUJCOKPPJCA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
