Molecular Structure:
CCD No.:CCD03399708
SELENA SEL10739934
Formula:C14 H23 N3 O2
MolWeight:265.355
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739934 |
| English Synonyms： | SELENA SEL10739934 |
| MDL Number.： | MFCD17133987 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CCC(CC)(Cc1nnc2n1CCCCC2)C(=O)O |
| InChi： | InChI=1S/C14H23N3O2/c1-3-14(4-2,13(18)19)10-12-16-15-11-8-6-5-7-9-17(11)12/h3-10H2,1-2H3,(H,18,19) |
| InChiKey： | InChIKey=YTLGKDVSDROIEF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
