Molecular Structure:
CCD No.:CCD03399867
SELENA SEL10740104
Formula:C17 H28 N2
MolWeight:260.422
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10740104 |
| English Synonyms： | SELENA SEL10740104 |
| MDL Number.： | MFCD17134148 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CC(C)C(C(c1ccccc1)N)N(C)CC2CCC2 |
| InChi： | InChI=1S/C17H28N2/c1-13(2)17(19(3)12-14-8-7-9-14)16(18)15-10-5-4-6-11-15/h4-6,10-11,13-14,16-17H,7-9,12,18H2,1-3H3 |
| InChiKey： | InChIKey=ILDAUXATOTYMRX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
