Molecular Structure:
CCD No.:CCD03399962
SELENA SEL10740200
Formula:C15 H19 N O2
MolWeight:245.32
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10740200 |
| English Synonyms： | SELENA SEL10740200 |
| MDL Number.： | MFCD17134244 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CN(CC1CCC1)c2ccc(cc2)/C=C/C(=O)O |
| InChi： | InChI=1S/C15H19NO2/c1-16(11-13-3-2-4-13)14-8-5-12(6-9-14)7-10-15(17)18/h5-10,13H,2-4,11H2,1H3,(H,17,18)/b10-7+ |
| InChiKey： | InChIKey=ARSSARCXVSFFMC-JXMROGBWSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
