* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL((1-[5-(5-METHYL-1,2-OXAZOL-4-YL)-1,3,4-OXADIAZOL-2-YL]PROPYL))AMINE |
| English Synonyms: | ETHYL((1-[5-(5-METHYL-1,2-OXAZOL-4-YL)-1,3,4-OXADIAZOL-2-YL]PROPYL))AMINE |
| MDL Number.: | MFCD17134858 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCC(c1nnc(o1)c2cnoc2C)NCC |
| InChi: | InChI=1S/C11H16N4O2/c1-4-9(12-5-2)11-15-14-10(16-11)8-6-13-17-7(8)3/h6,9,12H,4-5H2,1-3H3 |
| InChiKey: | InChIKey=MXQOUDPTESXRRX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.