* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(1,4-OXAZEPAN-4-YL)-2,3-DIHYDRO-1H-INDOLE-2,3-DIONE |
English Synonyms: | 6-(1,4-OXAZEPAN-4-YL)-2,3-DIHYDRO-1H-INDOLE-2,3-DIONE |
MDL Number.: | MFCD17149713 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1N3CCCOCC3)NC(=O)C2=O |
InChi: | InChI=1S/C13H14N2O3/c16-12-10-3-2-9(8-11(10)14-13(12)17)15-4-1-6-18-7-5-15/h2-3,8H,1,4-7H2,(H,14,16,17) |
InChiKey: | InChIKey=GFLMNTZIJXLNLX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.