Molecular Structure:
CCD No.:CCD03418843
OTAVA-BB 3549578
Formula:C17 H26 N2
MolWeight:258.406
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 3549578 |
| English Synonyms： | OTAVA-BB 3549578 |
| MDL Number.： | MFCD17154083 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1ccc(cc1)CC2CCN(CC2)CC3CCNC3 |
| InChi： | InChI=1S/C17H26N2/c1-2-4-15(5-3-1)12-16-7-10-19(11-8-16)14-17-6-9-18-13-17/h1-5,16-18H,6-14H2 |
| InChiKey： | InChIKey=VZMIFNSZDKPWEV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
