* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-[3-(CHLOROMETHYL)BENZOYL]-5H,6H,7H,8H-IMIDAZO[1,2-A]PYRAZINE |
| English Synonyms: | 7-[3-(CHLOROMETHYL)BENZOYL]-5H,6H,7H,8H-IMIDAZO[1,2-A]PYRAZINE |
| MDL Number.: | MFCD17156653 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1cc(cc(c1)C(=O)N2CCn3ccnc3C2)CCl |
| InChi: | InChI=1S/C14H14ClN3O/c15-9-11-2-1-3-12(8-11)14(19)18-7-6-17-5-4-16-13(17)10-18/h1-5,8H,6-7,9-10H2 |
| InChiKey: | InChIKey=FWEPYWCGEXDUJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.