* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXAN-4-YL 5-AMINO-2,3-DIMETHYLBENZOATE |
| English Synonyms: | OXAN-4-YL 5-AMINO-2,3-DIMETHYLBENZOATE |
| MDL Number.: | MFCD17157461 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1cc(cc(c1C)C(=O)OC2CCOCC2)N |
| InChi: | InChI=1S/C14H19NO3/c1-9-7-11(15)8-13(10(9)2)14(16)18-12-3-5-17-6-4-12/h7-8,12H,3-6,15H2,1-2H3 |
| InChiKey: | InChIKey=SNASHCIVWIZCDH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.