* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BHF 177 |
| CAS: | 917896-43-6 |
| English Synonyms: | BHF 177 |
| MDL Number.: | MFCD17167059 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1ncc(c(n1)N[C@@H]2C[C@H]3CC[C@@H]2C3)c4ccc(cc4)C(F)(F)F |
| InChi: | InChI=1S/C19H20F3N3/c1-11-23-10-16(13-4-6-15(7-5-13)19(20,21)22)18(24-11)25-17-9-12-2-3-14(17)8-12/h4-7,10,12,14,17H,2-3,8-9H2,1H3,(H,23,24,25)/t12-,14+,17+/m0/s1 |
| InChiKey: | InChIKey=ADHZHPOKTRHZGT-DXCKQFNASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.