Molecular Structure:
CCD No.:CCD03430986
ZERENEX E/0102296
Formula:C12 H15 Cl O2
MolWeight:226.702
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/0102296 |
| English Synonyms： | ZERENEX E/0102296 |
| MDL Number.： | MFCD17167566 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | CC(C)(C)c1ccc(c(c1)C(=O)Cl)OC |
| InChi： | InChI=1S/C12H15ClO2/c1-12(2,3)8-5-6-10(15-4)9(7-8)11(13)14/h5-7H,1-4H3 |
| InChiKey： | InChIKey=UZCFGXWUJZZXQA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
