* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(3-AMINOPHENYL)HEXANAL |
English Synonyms: | 6-(3-AMINOPHENYL)HEXANAL |
MDL Number.: | MFCD17168649 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)N)CCCCCC=O |
InChi: | InChI=1S/C12H17NO/c13-12-8-5-7-11(10-12)6-3-1-2-4-9-14/h5,7-10H,1-4,6,13H2 |
InChiKey: | InChIKey=ZQTZJJGUCRDVHN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.