* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BENZYL-5,6,7,8-TETRAHYDRO-1,7-NAPHTHYRIDINE-2,4-DIOL |
| English Synonyms: | 7-BENZYL-5,6,7,8-TETRAHYDRO-1,7-NAPHTHYRIDINE-2,4-DIOL |
| MDL Number.: | MFCD17169702 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)CN2CCc3c(cc(nc3C2)O)O |
| InChi: | InChI=1S/C15H16N2O2/c18-14-8-15(19)16-13-10-17(7-6-12(13)14)9-11-4-2-1-3-5-11/h1-5,8H,6-7,9-10H2,(H2,16,18,19) |
| InChiKey: | InChIKey=KPEFYZUJMQNGLH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.