* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-3-FLUORO-1,8-NAPHTHYRIDIN-2-AMINE |
| English Synonyms: | 7-CHLORO-3-FLUORO-1,8-NAPHTHYRIDIN-2-AMINE |
| MDL Number.: | MFCD17169773 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc(nc2c1cc(c(n2)N)F)Cl |
| InChi: | InChI=1S/C8H5ClFN3/c9-6-2-1-4-3-5(10)7(11)13-8(4)12-6/h1-3H,(H2,11,12,13) |
| InChiKey: | InChIKey=RJXZBWMHGNXXOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.