* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-BROMO-5-NITRO-1-TRITYL-1H-INDAZOLE |
| CAS: | 942189-39-1 |
| English Synonyms: | 3-BROMO-5-NITRO-1-TRITYL-1H-INDAZOLE |
| MDL Number.: | MFCD17169854 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)C(c2ccccc2)(c3ccccc3)n4c5ccc(cc5c(n4)Br)[N+](=O)[O-] |
| InChi: | InChI=1S/C26H18BrN3O2/c27-25-23-18-22(30(31)32)16-17-24(23)29(28-25)26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H |
| InChiKey: | InChIKey=PDUHZXZECHMGLL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.