* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-BROMO-2-METHYLBENZAMIDE |
| CAS: | 919363-09-0 |
| English Synonyms: | 3-BROMO-2-METHYLBENZAMIDE |
| MDL Number.: | MFCD17170782 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1c(cccc1Br)C(=O)N |
| InChi: | InChI=1S/C8H8BrNO/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H2,10,11) |
| InChiKey: | InChIKey=OADZVXZARJCFMF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.