* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO-1,2,6-TRIFLUORO-5,10-DIHYDROINDENO[1,2-B]INDOLE |
| English Synonyms: | 8-CHLORO-1,2,6-TRIFLUORO-5,10-DIHYDROINDENO[1,2-B]INDOLE |
| MDL Number.: | MFCD17180967 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1cc(c(c2c1-c3c(c4cc(cc(c4[nH]3)F)Cl)C2)F)F |
| InChi: | InChI=1S/C15H7ClF3N/c16-6-3-9-10-5-8-7(1-2-11(17)13(8)19)14(10)20-15(9)12(18)4-6/h1-4,20H,5H2 |
| InChiKey: | InChIKey=IVFIHDFTAWUNLJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.