* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | KINGSHCHEM 24182 |
English Synonyms: | KINGSHCHEM 24182 |
MDL Number.: | MFCD17181290 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1c(cc(c-2c1Cc3c2nc(s3)Br)Cl)Cl |
InChi: | InChI=1S/C10H4BrCl2NS/c11-10-14-9-7(15-10)2-4-1-5(12)3-6(13)8(4)9/h1,3H,2H2 |
InChiKey: | InChIKey=GZPFEVSLOWKBTB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.