* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 24350 |
| English Synonyms: | KINGSHCHEM 24350 |
| MDL Number.: | MFCD17181442 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COc1cc2c(c(c1OC)OC)-c3c(sc(=O)[nH]3)C2 |
| InChi: | InChI=1S/C13H13NO4S/c1-16-7-4-6-5-8-10(14-13(15)19-8)9(6)12(18-3)11(7)17-2/h4H,5H2,1-3H3,(H,14,15) |
| InChiKey: | InChIKey=YWEHZGBJTSVNOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.