* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | KINGSHCHEM 24674 |
English Synonyms: | KINGSHCHEM 24674 |
MDL Number.: | MFCD17181739 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(c(cc1F)c2c-3c(on2)CCc4c3nc(s4)I)F |
InChi: | InChI=1S/C14H7F2IN2OS/c15-6-1-2-8(16)7(5-6)12-11-9(20-19-12)3-4-10-13(11)18-14(17)21-10/h1-2,5H,3-4H2 |
InChiKey: | InChIKey=TXYSQVWMFRBUBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.