* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 25530 |
| English Synonyms: | KINGSHCHEM 25530 |
| MDL Number.: | MFCD17182252 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCOc1ccc2c(c1)nc(s2)CCN |
| InChi: | InChI=1S/C11H14N2OS/c1-2-14-8-3-4-10-9(7-8)13-11(15-10)5-6-12/h3-4,7H,2,5-6,12H2,1H3 |
| InChiKey: | InChIKey=CJRLPZDOPQJJRU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.