* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | KINGSHCHEM 28868 |
English Synonyms: | KINGSHCHEM 28868 |
MDL Number.: | MFCD17184630 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2ccc(cc2)c3cn(cc3C#N)CC(=O)O |
InChi: | InChI=1S/C19H14N2O2/c20-10-17-11-21(13-19(22)23)12-18(17)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-9,11-12H,13H2,(H,22,23) |
InChiKey: | InChIKey=QLFMPNWNYYSTFE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.