* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 33168 |
| English Synonyms: | KINGSHCHEM 33168 |
| MDL Number.: | MFCD17188714 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1cc2c(cc1C)nc([nH]2)Sc3ccc(cc3)/N=C(\N)/SC |
| InChi: | InChI=1S/C17H18N4S2/c1-10-8-14-15(9-11(10)2)21-17(20-14)23-13-6-4-12(5-7-13)19-16(18)22-3/h4-9H,1-3H3,(H2,18,19)(H,20,21) |
| InChiKey: | InChIKey=DZNRNAIODPZQCL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.