* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | KINGSHCHEM 33170 |
English Synonyms: | KINGSHCHEM 33170 |
MDL Number.: | MFCD17188716 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CS/C(=N/c1ccc(cc1)Sc2[nH]c3cc(c(cc3n2)Cl)Cl)/N |
InChi: | InChI=1S/C15H12Cl2N4S2/c1-22-14(18)19-8-2-4-9(5-3-8)23-15-20-12-6-10(16)11(17)7-13(12)21-15/h2-7H,1H3,(H2,18,19)(H,20,21) |
InChiKey: | InChIKey=AZBWFBRKYALGTN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.