* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | KINGSHCHEM 33265 |
English Synonyms: | KINGSHCHEM 33265 |
MDL Number.: | MFCD17188811 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCN/C(=N\c1ccc(cc1)Sc2[nH]c3ccc(cc3n2)OC(F)F)/SCC |
InChi: | InChI=1S/C19H20F2N4OS2/c1-3-22-18(27-4-2)23-12-5-8-14(9-6-12)28-19-24-15-10-7-13(26-17(20)21)11-16(15)25-19/h5-11,17H,3-4H2,1-2H3,(H,22,23)(H,24,25) |
InChiKey: | InChIKey=TWVQJZHYXNLCBO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.