* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 33279 |
| English Synonyms: | KINGSHCHEM 33279 |
| MDL Number.: | MFCD17188825 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCCN/C(=N\c1ccc(cc1)Sc2[nH]c3ccc(cc3n2)OC(F)F)/SCC |
| InChi: | InChI=1S/C20H22F2N4OS2/c1-3-11-23-19(28-4-2)24-13-5-8-15(9-6-13)29-20-25-16-10-7-14(27-18(21)22)12-17(16)26-20/h5-10,12,18H,3-4,11H2,1-2H3,(H,23,24)(H,25,26) |
| InChiKey: | InChIKey=FVOLWATZUPEFNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.