* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 33280 |
| English Synonyms: | KINGSHCHEM 33280 |
| MDL Number.: | MFCD17188826 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCCN/C(=N\c1ccc(cc1)Sc2[nH]c3cc(c(cc3n2)C)C)/SCC |
| InChi: | InChI=1S/C21H26N4S2/c1-5-11-22-20(26-6-2)23-16-7-9-17(10-8-16)27-21-24-18-12-14(3)15(4)13-19(18)25-21/h7-10,12-13H,5-6,11H2,1-4H3,(H,22,23)(H,24,25) |
| InChiKey: | InChIKey=YGPLXFXKGXFHDL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.