* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH1358109 |
English Synonyms: | FCHGROUP FCH1358109 |
MDL Number.: | MFCD17189019 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCS/C(=N/Cc1ccc(cc1)F)/N |
InChi: | InChI=1S/C10H13FN2S/c1-2-14-10(12)13-7-8-3-5-9(11)6-4-8/h3-6H,2,7H2,1H3,(H2,12,13) |
InChiKey: | InChIKey=KMDHQQVRBGJQIK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.