* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | KINGSHCHEM 33742 |
English Synonyms: | KINGSHCHEM 33742 |
MDL Number.: | MFCD17189192 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCN/C(=N\CCc1ccccc1)/SC |
InChi: | InChI=1S/C12H18N2S/c1-3-13-12(15-2)14-10-9-11-7-5-4-6-8-11/h4-8H,3,9-10H2,1-2H3,(H,13,14) |
InChiKey: | InChIKey=QEFHJFLXAGZXER-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.