* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 33752 |
| English Synonyms: | KINGSHCHEM 33752 |
| MDL Number.: | MFCD17189202 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCN/C(=N\Cc1ccccc1C)/SCC |
| InChi: | InChI=1S/C13H20N2S/c1-4-14-13(16-5-2)15-10-12-9-7-6-8-11(12)3/h6-9H,4-5,10H2,1-3H3,(H,14,15) |
| InChiKey: | InChIKey=ZBSCUMIOIJVXFQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.