* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | KINGSHCHEM 35712 |
English Synonyms: | KINGSHCHEM 35712 |
MDL Number.: | MFCD17190446 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | c1ccc(c(c1)c2[nH]c(=O)c(c(n2)O)N)N |
InChi: | InChI=1S/C10H10N4O2/c11-6-4-2-1-3-5(6)8-13-9(15)7(12)10(16)14-8/h1-4H,11-12H2,(H2,13,14,15,16) |
InChiKey: | InChIKey=ZYPIMKHINXDZPY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.