* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | KINGSHCHEM 46152 |
English Synonyms: | KINGSHCHEM 46152 |
MDL Number.: | MFCD17195758 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCOC(=O)c1c2c(n(n1)c3ccc(cc3)F)-c4cc(ccc4C2)C |
InChi: | InChI=1S/C20H17FN2O2/c1-3-25-20(24)18-17-11-13-5-4-12(2)10-16(13)19(17)23(22-18)15-8-6-14(21)7-9-15/h4-10H,3,11H2,1-2H3 |
InChiKey: | InChIKey=ZWMXICBJZUBPCP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.