* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | KINGSHCHEM 46866 |
English Synonyms: | KINGSHCHEM 46866 |
MDL Number.: | MFCD17195778 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCc1ccc2c(c1)-c3c(c(nn3c4ccc(cc4)C(F)(F)F)C(=O)OCC)C2 |
InChi: | InChI=1S/C22H19F3N2O2/c1-3-13-5-6-14-12-18-19(21(28)29-4-2)26-27(20(18)17(14)11-13)16-9-7-15(8-10-16)22(23,24)25/h5-11H,3-4,12H2,1-2H3 |
InChiKey: | InChIKey=CXGIACZWPPMMGL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.