* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-FLUORO-6,11-DIHYDRO-5H-BENZO[A]CARBAZOLE |
| CAS: | 50823-79-5 |
| English Synonyms: | 8-FLUORO-6,11-DIHYDRO-5H-BENZO[A]CARBAZOLE |
| MDL Number.: | MFCD17197689 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1ccc-2c(c1)CCc3c2[nH]c4c3cc(cc4)F |
| InChi: | InChI=1S/C16H12FN/c17-11-6-8-15-14(9-11)13-7-5-10-3-1-2-4-12(10)16(13)18-15/h1-4,6,8-9,18H,5,7H2 |
| InChiKey: | InChIKey=LBAPVCLIDQVZIZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.