* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6,8-DIFLUORO-5,10-DIHYDROINDENO[1,2-B]INDOLE |
English Synonyms: | 6,8-DIFLUORO-5,10-DIHYDROINDENO[1,2-B]INDOLE |
MDL Number.: | MFCD17198347 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc-2c(c1)Cc3c2[nH]c4c3cc(cc4F)F |
InChi: | InChI=1S/C15H9F2N/c16-9-6-12-11-5-8-3-1-2-4-10(8)14(11)18-15(12)13(17)7-9/h1-4,6-7,18H,5H2 |
InChiKey: | InChIKey=OPKZAQKOTGFJNH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.