* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 10920 |
| English Synonyms: | KINGSHCHEM 10920 |
| MDL Number.: | MFCD17212471 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)[Si](C)(C)OC(CCCO)c1ccccc1Cl |
| InChi: | InChI=1S/C16H27ClO2Si/c1-16(2,3)20(4,5)19-15(11-8-12-18)13-9-6-7-10-14(13)17/h6-7,9-10,15,18H,8,11-12H2,1-5H3 |
| InChiKey: | InChIKey=MKFLFMIDYXLIQV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.