* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | KINGSHCHEM 10966 |
English Synonyms: | KINGSHCHEM 10966 |
MDL Number.: | MFCD17212480 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C1[C@@H]2C[C@H]3C[C@@](C2)(C[C@@H]1C3N)N.Cl.Cl |
InChi: | InChI=1S/C10H18N2.2ClH/c11-9-7-1-6-2-8(9)5-10(12,3-6)4-7;;/h6-9H,1-5,11-12H2;2*1H/t6-,7-,8+,9?,10-;; |
InChiKey: | InChIKey=LHIZCZVMVIEZCR-QZFHIGDGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.