* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHOXY-2H-1,4-BENZOTHIAZIN-3(4H)-ONE |
| English Synonyms: | 8-METHOXY-3,4-DIHYDRO-2H-1,4-BENZOTHIAZIN-3-ONE ; 8-METHOXY-2H-1,4-BENZOTHIAZIN-3(4H)-ONE |
| MDL Number.: | MFCD17212484 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | COc1cccc2c1SCC(=O)N2 |
| InChi: | InChI=1S/C9H9NO2S/c1-12-7-4-2-3-6-9(7)13-5-8(11)10-6/h2-4H,5H2,1H3,(H,10,11) |
| InChiKey: | InChIKey=KHYWJQACHSYPIL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.