* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(1,1-DIMETHYLETHYL)-2H-1,4-BENZOTHIAZIN-3(4H)-ONE |
| English Synonyms: | 7-(1,1-DIMETHYLETHYL)-2H-1,4-BENZOTHIAZIN-3(4H)-ONE |
| MDL Number.: | MFCD17212487 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)c1ccc2c(c1)SCC(=O)N2 |
| InChi: | InChI=1S/C12H15NOS/c1-12(2,3)8-4-5-9-10(6-8)15-7-11(14)13-9/h4-6H,7H2,1-3H3,(H,13,14) |
| InChiKey: | InChIKey=KHBLAWJMSGUVGO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.