* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-BROMO-2-METHYL-3,4-DIHYDRO-2H-1,4-BENZOTHIAZIN-3-ONE |
English Synonyms: | 6-BROMO-2-METHYL-3,4-DIHYDRO-2H-1,4-BENZOTHIAZIN-3-ONE |
MDL Number.: | MFCD17212513 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC1C(=O)Nc2cc(ccc2S1)Br |
InChi: | InChI=1S/C9H8BrNOS/c1-5-9(12)11-7-4-6(10)2-3-8(7)13-5/h2-5H,1H3,(H,11,12) |
InChiKey: | InChIKey=WUBGRNFSCYNDSN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.