* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-CHLORO-2,5-DIMETHYL-3,4-DIHYDRO-2H-1,4-BENZOTHIAZIN-3-ONE |
| English Synonyms: | 6-CHLORO-2,5-DIMETHYL-3,4-DIHYDRO-2H-1,4-BENZOTHIAZIN-3-ONE |
| MDL Number.: | MFCD17212587 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1c(ccc2c1NC(=O)C(S2)C)Cl |
| InChi: | InChI=1S/C10H10ClNOS/c1-5-7(11)3-4-8-9(5)12-10(13)6(2)14-8/h3-4,6H,1-2H3,(H,12,13) |
| InChiKey: | InChIKey=SENMYOVAEARPTC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.