* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | KINGSHCHEM 68268 |
English Synonyms: | KINGSHCHEM 68268 |
MDL Number.: | MFCD17212751 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1c(cc(c2c1NC(=O)C(S2)C(=O)O)F)F |
InChi: | InChI=1S/C9H5F2NO3S/c10-3-1-4(11)6-5(2-3)12-8(13)7(16-6)9(14)15/h1-2,7H,(H,12,13)(H,14,15) |
InChiKey: | InChIKey=AULYECDKZOCFEF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.