* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | KINGSHCHEM 68285 |
English Synonyms: | KINGSHCHEM 68285 |
MDL Number.: | MFCD17212768 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC(=O)CC1C(=O)Nc2c(cccc2Cl)S1 |
InChi: | InChI=1S/C12H12ClNO3S/c1-2-17-10(15)6-9-12(16)14-11-7(13)4-3-5-8(11)18-9/h3-5,9H,2,6H2,1H3,(H,14,16) |
InChiKey: | InChIKey=GSNFSESVDHTXEQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.