* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 68570 |
| English Synonyms: | KINGSHCHEM 68570 |
| MDL Number.: | MFCD17213041 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)C(C)N1c2cc(ccc2SCC1=O)Br |
| InChi: | InChI=1S/C13H14BrNO3S/c1-3-18-13(17)8(2)15-10-6-9(14)4-5-11(10)19-7-12(15)16/h4-6,8H,3,7H2,1-2H3 |
| InChiKey: | InChIKey=LDIUJOYVRORPEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.