* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | KINGSHCHEM 68832 |
English Synonyms: | KINGSHCHEM 68832 |
MDL Number.: | MFCD17213303 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC1C(=O)N(c2c(ccc(c2S1)Cl)Cl)C(=O)CCl |
InChi: | InChI=1S/C11H8Cl3NO2S/c1-5-11(17)15(8(16)4-12)9-6(13)2-3-7(14)10(9)18-5/h2-3,5H,4H2,1H3 |
InChiKey: | InChIKey=IEXMIPPXCQPGJT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.