* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | KINGSHCHEM 68836 |
English Synonyms: | KINGSHCHEM 68836 |
MDL Number.: | MFCD17213307 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | Cc1cc(c2c(c1)SC(C(=O)N2C(=O)CCl)C)C |
InChi: | InChI=1S/C13H14ClNO2S/c1-7-4-8(2)12-10(5-7)18-9(3)13(17)15(12)11(16)6-14/h4-5,9H,6H2,1-3H3 |
InChiKey: | InChIKey=LCPZSIVKIVKJIG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.